ChemNet > CAS > 175202-90-1 1-Chlor-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-on
175202-90-1 1-Chlor-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-on
| Produkt-Name |
1-Chlor-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-on |
| Synonyme |
1-Chlor-6,6-dimethyl-3-(methylsulfanyl)-6,7-dihydro-2-benzothiophen-4(5H)-on |
| Englischer Name |
1-chloro-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one;1-chloro-6,6-dimethyl-3-(methylsulfanyl)-6,7-dihydro-2-benzothiophen-4(5H)-one |
| Molekulare Formel |
C11H13ClOS2 |
| Molecular Weight |
260.8033 |
| InChI |
InChI=1/C11H13ClOS2/c1-11(2)4-6-8(7(13)5-11)10(14-3)15-9(6)12/h4-5H2,1-3H3 |
| CAS Registry Number |
175202-90-1 |
| Molecular Structure |
|
| Dichte |
1.31g/cm3 |
| Schmelzpunkt |
126℃ |
| Siedepunkt |
366.5°C at 760 mmHg |
| Brechungsindex |
1.604 |
| Flammpunkt |
175.5°C |
| Dampfdruck |
1.46E-05mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|